C40H33NO9 — CID 131883942
[(2R,3R,4S)-2,3,4-tribenzoyloxy-5-phenylmethoxyiminopentyl] benzoate (PubChem CID 131883942) has the molecular formula C40H33NO9 and a molecular weight of 671.70 g/mol. Its IUPAC name is [(2R,3R,4S)-2,3,4-tribenzoyloxy-5-phenylmethoxyiminopentyl] benzoate.
| Compound Name | [(2R,3R,4S)-2,3,4-tribenzoyloxy-5-phenylmethoxyiminopentyl] benzoate |
|---|---|
| PubChem CID | 131883942 |
| Molecular Formula | C40H33NO9 |
| Molecular Weight | 671.70 g/mol |
| Exact Mass | 671.22 |
| IUPAC Name | [(2R,3R,4S)-2,3,4-tribenzoyloxy-5-phenylmethoxyiminopentyl] benzoate |
| SMILES | O=C(OC[C@@H](OC(=O)c1ccccc1)[C@H](OC(=O)c1ccccc1)[C@H](C=NOCc1ccccc1)OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H33NO9/c42-37(30-18-8-2-9-19-30)46-28-35(49-39(44)32-22-12-4-13-23-32)36(50-40(45)33-24-14-5-15-25-33)34(48-38(43)31-20-10-3-11-21-31)26-41-47-27-29-16-6-1-7-17-29/h1-26,34-36H,27-28H2/t34-,35+,36+/m0/s1 |
| InChIKey | HTCZBOCTUCJZPO-LIVOIKKVSA-N |
| XLogP | 6.72 |
| TPSA | 126.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.70 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|