C48H39NO11 — CID 71440078
(2,3,4,6-tetrabenzoyloxy-5-phenylmethoxyiminohexyl) benzoate (PubChem CID 71440078) has the molecular formula C48H39NO11 and a molecular weight of 805.84 g/mol. Its IUPAC name is (2,3,4,6-tetrabenzoyloxy-5-phenylmethoxyiminohexyl) benzoate.
| Compound Name | (2,3,4,6-tetrabenzoyloxy-5-phenylmethoxyiminohexyl) benzoate |
|---|---|
| PubChem CID | 71440078 |
| Molecular Formula | C48H39NO11 |
| Molecular Weight | 805.84 g/mol |
| Exact Mass | 805.25 |
| IUPAC Name | (2,3,4,6-tetrabenzoyloxy-5-phenylmethoxyiminohexyl) benzoate |
| SMILES | O=C(OCC(=NOCc1ccccc1)C(OC(=O)c1ccccc1)C(OC(=O)c1ccccc1)C(COC(=O)c1ccccc1)OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C48H39NO11/c50-44(35-21-9-2-10-22-35)55-32-40(49-57-31-34-19-7-1-8-20-34)42(59-47(53)38-27-15-5-16-28-38)43(60-48(54)39-29-17-6-18-30-39)41(58-46(52)37-25-13-4-14-26-37)33-56-45(51)36-23-11-3-12-24-36/h1-30,41-43H,31-33H2 |
| InChIKey | BCQSSVICCNLYDX-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 153.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.84 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|