C36H32O11 — CID 54433659
[(2R,3R,4S,5R)-2,4,5-tribenzoyloxy-6-ethoxy-3-hydroxy-6-oxohexyl] benzoate (PubChem CID 54433659) has the molecular formula C36H32O11 and a molecular weight of 640.64 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-2,4,5-tribenzoyloxy-6-ethoxy-3-hydroxy-6-oxohexyl] benzoate.
| Compound Name | [(2R,3R,4S,5R)-2,4,5-tribenzoyloxy-6-ethoxy-3-hydroxy-6-oxohexyl] benzoate |
|---|---|
| PubChem CID | 54433659 |
| Molecular Formula | C36H32O11 |
| Molecular Weight | 640.64 g/mol |
| Exact Mass | 640.19 |
| IUPAC Name | [(2R,3R,4S,5R)-2,4,5-tribenzoyloxy-6-ethoxy-3-hydroxy-6-oxohexyl] benzoate |
| SMILES | CCOC(=O)[C@H](OC(=O)c1ccccc1)[C@@H](OC(=O)c1ccccc1)[C@H](O)[C@@H](COC(=O)c1ccccc1)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C36H32O11/c1-2-43-36(42)31(47-35(41)27-21-13-6-14-22-27)30(46-34(40)26-19-11-5-12-20-26)29(37)28(45-33(39)25-17-9-4-10-18-25)23-44-32(38)24-15-7-3-8-16-24/h3-22,28-31,37H,2,23H2,1H3/t28-,29-,30+,31-/m1/s1 |
| InChIKey | WJGCATSMFGHOTN-LTXXGDHTSA-N |
| XLogP | 4.44 |
| TPSA | 151.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.64 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|