C40H38O6 — CID 5084613
[6-oxo-6-phenyl-1,3,4-tris(phenylmethoxy)hexan-2-yl] benzoate (PubChem CID 5084613) has the molecular formula C40H38O6 and a molecular weight of 614.74 g/mol. Its IUPAC name is [6-oxo-6-phenyl-1,3,4-tris(phenylmethoxy)hexan-2-yl] benzoate.
| Compound Name | [6-oxo-6-phenyl-1,3,4-tris(phenylmethoxy)hexan-2-yl] benzoate |
|---|---|
| PubChem CID | 5084613 |
| Molecular Formula | C40H38O6 |
| Molecular Weight | 614.74 g/mol |
| Exact Mass | 614.27 |
| IUPAC Name | [6-oxo-6-phenyl-1,3,4-tris(phenylmethoxy)hexan-2-yl] benzoate |
| SMILES | O=C(CC(OCc1ccccc1)C(OCc1ccccc1)C(COCc1ccccc1)OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H38O6/c41-36(34-22-12-4-13-23-34)26-37(44-28-32-18-8-2-9-19-32)39(45-29-33-20-10-3-11-21-33)38(30-43-27-31-16-6-1-7-17-31)46-40(42)35-24-14-5-15-25-35/h1-25,37-39H,26-30H2 |
| InChIKey | AIAXMKJYEHMHJL-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.74 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |