C48H50N2O9S2 — CID 71518762
[(2R,3S,4R,5S)-5,6-bis[(4-methylphenyl)sulfonylamino]-1,3,4-tris(phenylmethoxy)hexan-2-yl] benzoate (PubChem CID 71518762) has the molecular formula C48H50N2O9S2 and a molecular weight of 863.07 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-5,6-bis[(4-methylphenyl)sulfonylamino]-1,3,4-tris(phenylmethoxy)hexan-2-yl] benzoate.
| Compound Name | [(2R,3S,4R,5S)-5,6-bis[(4-methylphenyl)sulfonylamino]-1,3,4-tris(phenylmethoxy)hexan-2-yl] benzoate |
|---|---|
| PubChem CID | 71518762 |
| Molecular Formula | C48H50N2O9S2 |
| Molecular Weight | 863.07 g/mol |
| Exact Mass | 862.30 |
| IUPAC Name | [(2R,3S,4R,5S)-5,6-bis[(4-methylphenyl)sulfonylamino]-1,3,4-tris(phenylmethoxy)hexan-2-yl] benzoate |
| SMILES | Cc1ccc(S(=O)(=O)NC[C@H](NS(=O)(=O)c2ccc(C)cc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](COCc2ccccc2)OC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C48H50N2O9S2/c1-36-23-27-42(28-24-36)60(52,53)49-31-44(50-61(54,55)43-29-25-37(2)26-30-43)46(57-33-39-17-9-4-10-18-39)47(58-34-40-19-11-5-12-20-40)45(35-56-32-38-15-7-3-8-16-38)59-48(51)41-21-13-6-14-22-41/h3-30,44-47,49-50H,31-35H2,1-2H3/t44-,45+,46+,47+/m0/s1 |
| InChIKey | FMCMIOUQVWGALG-VXAVGFPTSA-N |
| XLogP | 7.54 |
| TPSA | 146.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.07 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |