C47H40O14S2 — CID 99689503
[(2R,3R,4S,5S)-1-(benzenesulfonyloxy)-3,4,5-tribenzoyloxy-6-(4-methylphenyl)sulfonyloxyhexan-2-yl] benzoate (PubChem CID 99689503) has the molecular formula C47H40O14S2 and a molecular weight of 892.96 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-1-(benzenesulfonyloxy)-3,4,5-tribenzoyloxy-6-(4-methylphenyl)sulfonyloxyhexan-2-yl] benzoate.
| Compound Name | [(2R,3R,4S,5S)-1-(benzenesulfonyloxy)-3,4,5-tribenzoyloxy-6-(4-methylphenyl)sulfonyloxyhexan-2-yl] benzoate |
|---|---|
| PubChem CID | 99689503 |
| Molecular Formula | C47H40O14S2 |
| Molecular Weight | 892.96 g/mol |
| Exact Mass | 892.19 |
| IUPAC Name | [(2R,3R,4S,5S)-1-(benzenesulfonyloxy)-3,4,5-tribenzoyloxy-6-(4-methylphenyl)sulfonyloxyhexan-2-yl] benzoate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H](OC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@@H](COS(=O)(=O)c2ccccc2)OC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C47H40O14S2/c1-33-27-29-39(30-28-33)63(54,55)57-32-41(59-45(49)35-19-9-3-10-20-35)43(61-47(51)37-23-13-5-14-24-37)42(60-46(50)36-21-11-4-12-22-36)40(58-44(48)34-17-7-2-8-18-34)31-56-62(52,53)38-25-15-6-16-26-38/h2-30,40-43H,31-32H2,1H3/t40-,41+,42-,43+/m1/s1 |
| InChIKey | UWKYJUWMVCYLNX-BWQHEFHFSA-N |
| XLogP | 7.01 |
| TPSA | 191.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 892.96 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|