C20H22O5S — CID 101029873
[(2R,3R)-2-(4-methylphenyl)sulfonyloxyhex-5-en-3-yl] benzoate (PubChem CID 101029873) has the molecular formula C20H22O5S and a molecular weight of 374.46 g/mol. Its IUPAC name is [(2R,3R)-2-(4-methylphenyl)sulfonyloxyhex-5-en-3-yl] benzoate.
| Compound Name | [(2R,3R)-2-(4-methylphenyl)sulfonyloxyhex-5-en-3-yl] benzoate |
|---|---|
| PubChem CID | 101029873 |
| Molecular Formula | C20H22O5S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | [(2R,3R)-2-(4-methylphenyl)sulfonyloxyhex-5-en-3-yl] benzoate |
| SMILES | C=CC[C@@H](OC(=O)c1ccccc1)[C@@H](C)OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H22O5S/c1-4-8-19(24-20(21)17-9-6-5-7-10-17)16(3)25-26(22,23)18-13-11-15(2)12-14-18/h4-7,9-14,16,19H,1,8H2,2-3H3/t16-,19-/m1/s1 |
| InChIKey | PDGXSIBNOUTGBB-VQIMIIECSA-N |
| XLogP | 3.89 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|