C24H25NO7S2 — CID 10907265
[3-benzamido-2-(4-methylphenyl)sulfonyloxypropyl] 4-methylbenzenesulfonate (PubChem CID 10907265) has the molecular formula C24H25NO7S2 and a molecular weight of 503.60 g/mol. Its IUPAC name is [3-benzamido-2-(4-methylphenyl)sulfonyloxypropyl] 4-methylbenzenesulfonate.
| Compound Name | [3-benzamido-2-(4-methylphenyl)sulfonyloxypropyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10907265 |
| Molecular Formula | C24H25NO7S2 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.11 |
| IUPAC Name | [3-benzamido-2-(4-methylphenyl)sulfonyloxypropyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(CNC(=O)c2ccccc2)OS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H25NO7S2/c1-18-8-12-22(13-9-18)33(27,28)31-17-21(16-25-24(26)20-6-4-3-5-7-20)32-34(29,30)23-14-10-19(2)11-15-23/h3-15,21H,16-17H2,1-2H3,(H,25,26) |
| InChIKey | KYEZWPBIUPKOPT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|