C23H24O9S2 — CID 10744233
[(2S)-3-(2,3-dihydroxyphenoxy)-2-(4-methylphenyl)sulfonyloxypropyl] 4-methylbenzenesulfonate (PubChem CID 10744233) has the molecular formula C23H24O9S2 and a molecular weight of 508.57 g/mol. Its IUPAC name is [(2S)-3-(2,3-dihydroxyphenoxy)-2-(4-methylphenyl)sulfonyloxypropyl] 4-methylbenzenesulfonate.
| Compound Name | [(2S)-3-(2,3-dihydroxyphenoxy)-2-(4-methylphenyl)sulfonyloxypropyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10744233 |
| Molecular Formula | C23H24O9S2 |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.09 |
| IUPAC Name | [(2S)-3-(2,3-dihydroxyphenoxy)-2-(4-methylphenyl)sulfonyloxypropyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H](COc2cccc(O)c2O)OS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H24O9S2/c1-16-6-10-19(11-7-16)33(26,27)31-15-18(14-30-22-5-3-4-21(24)23(22)25)32-34(28,29)20-12-8-17(2)9-13-20/h3-13,18,24-25H,14-15H2,1-2H3/t18-/m0/s1 |
| InChIKey | LPIMSTUZGGUSTG-SFHVURJKSA-N |
| XLogP | 3.27 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|