C26H36O8S2 — CID 11092765
methyl 10,11-bis-(4-methylphenyl)sulfonyloxyundecanoate (PubChem CID 11092765) has the molecular formula C26H36O8S2 and a molecular weight of 540.70 g/mol. Its IUPAC name is methyl 10,11-bis-(4-methylphenyl)sulfonyloxyundecanoate.
| Compound Name | methyl 10,11-bis-(4-methylphenyl)sulfonyloxyundecanoate |
|---|---|
| PubChem CID | 11092765 |
| Molecular Formula | C26H36O8S2 |
| Molecular Weight | 540.70 g/mol |
| Exact Mass | 540.19 |
| IUPAC Name | methyl 10,11-bis-(4-methylphenyl)sulfonyloxyundecanoate |
| SMILES | COC(=O)CCCCCCCCC(COS(=O)(=O)c1ccc(C)cc1)OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C26H36O8S2/c1-21-12-16-24(17-13-21)35(28,29)33-20-23(10-8-6-4-5-7-9-11-26(27)32-3)34-36(30,31)25-18-14-22(2)15-19-25/h12-19,23H,4-11,20H2,1-3H3 |
| InChIKey | NPWXGVZXOSSJKH-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.70 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|