About [2-(11-bromoundecanoyloxy)-3-(4-methylphenyl)sulfonyloxypropyl] 11-bromoundecanoate
[2-(11-bromoundecanoyloxy)-3-(4-methylphenyl)sulfonyloxypropyl] 11-bromoundecanoate (PubChem CID 54035501) has the molecular formula C32H52Br2O7S
and a molecular weight of 740.64 g/mol. Its IUPAC name is [2-(11-bromoundecanoyloxy)-3-(4-methylphenyl)sulfonyloxypropyl] 11-bromoundecanoate.
Molecular Properties
| Compound Name | [2-(11-bromoundecanoyloxy)-3-(4-methylphenyl)sulfonyloxypropyl] 11-bromoundecanoate |
| PubChem CID | 54035501 |
| Molecular Formula | C32H52Br2O7S |
| Molecular Weight | 740.64 g/mol |
| Exact Mass | 738.18 |
| IUPAC Name | [2-(11-bromoundecanoyloxy)-3-(4-methylphenyl)sulfonyloxypropyl] 11-bromoundecanoate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(COC(=O)CCCCCCCCCCBr)OC(=O)CCCCCCCCCCBr)cc1 |
| InChI | InChI=1S/C32H52Br2O7S/c1-28-20-22-30(23-21-28)42(37,38)40-27-29(41-32(36)19-15-11-7-3-5-9-13-17-25-34)26-39-31(35)18-14-10-6-2-4-8-12-16-24-33/h20-23,29H,2-19,24-27H2,1H3 |
| InChIKey | LIQVYIRZFKBWRN-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 740.64 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [2-(11-bromoundecanoyloxy)-3-(4-methylphenyl)sulfonyloxypropyl] 11-bromoundecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(11-bromoundecanoyloxy)-3-(4-methylphenyl)sulfonyloxypropyl] 11-bromoundecanoate?
The IUPAC name of [2-(11-bromoundecanoyloxy)-3-(4-methylphenyl)sulfonyloxypropyl] 11-bromoundecanoate (CID 54035501) is [2-(11-bromoundecanoyloxy)-3-(4-methylphenyl)sulfonyloxypropyl] 11-bromoundecanoate.
What is the SMILES notation for [2-(11-bromoundecanoyloxy)-3-(4-methylphenyl)sulfonyloxypropyl] 11-bromoundecanoate?
The canonical SMILES for [2-(11-bromoundecanoyloxy)-3-(4-methylphenyl)sulfonyloxypropyl] 11-bromoundecanoate is Cc1ccc(S(=O)(=O)OCC(COC(=O)CCCCCCCCCCBr)OC(=O)CCCCCCCCCCBr)cc1.
What is the InChIKey of [2-(11-bromoundecanoyloxy)-3-(4-methylphenyl)sulfonyloxypropyl] 11-bromoundecanoate?
The InChIKey is LIQVYIRZFKBWRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H52Br2O7S/c1-28-20-22-30(23-21-28)42(37,38)40-27-29(41-32(36)19-15-11-7-3-5-9-13-17-25-34)26-39-31(35)18-14-10-6-2-4-8-12-16-24-33/h20-23,29H,2-19,24-27H2,1H3.
What are the key properties of [2-(11-bromoundecanoyloxy)-3-(4-methylphenyl)sulfonyloxypropyl] 11-bromoundecanoate?
[2-(11-bromoundecanoyloxy)-3-(4-methylphenyl)sulfonyloxypropyl] 11-bromoundecanoate has a molecular weight of 740.64 g/mol, XLogP of 8.97, 27 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(11-bromoundecanoyloxy)-3-(4-methylphenyl)sulfonyloxypropyl] 11-bromoundecanoate is sourced from PubChem (CID 54035501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).