C18H21NO6S — CID 11245935
[(2S)-2-hydroxy-3-(phenylmethoxycarbonylamino)propyl] 4-methylbenzenesulfonate (PubChem CID 11245935) has the molecular formula C18H21NO6S and a molecular weight of 379.43 g/mol. Its IUPAC name is [(2S)-2-hydroxy-3-(phenylmethoxycarbonylamino)propyl] 4-methylbenzenesulfonate.
| Compound Name | [(2S)-2-hydroxy-3-(phenylmethoxycarbonylamino)propyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11245935 |
| Molecular Formula | C18H21NO6S |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | [(2S)-2-hydroxy-3-(phenylmethoxycarbonylamino)propyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H](O)CNC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C18H21NO6S/c1-14-7-9-17(10-8-14)26(22,23)25-13-16(20)11-19-18(21)24-12-15-5-3-2-4-6-15/h2-10,16,20H,11-13H2,1H3,(H,19,21)/t16-/m0/s1 |
| InChIKey | OFCUCDOZWMYENZ-INIZCTEOSA-N |
| XLogP | 1.99 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|