C17H19NO3S2 — CID 10665488
[(2R,3S)-2-[(4-methyl-2-sulfanylidene-1,3-thiazol-3-yl)oxy]hex-5-en-3-yl] benzoate (PubChem CID 10665488) has the molecular formula C17H19NO3S2 and a molecular weight of 349.48 g/mol. Its IUPAC name is [(2R,3S)-2-[(4-methyl-2-sulfanylidene-1,3-thiazol-3-yl)oxy]hex-5-en-3-yl] benzoate.
| Compound Name | [(2R,3S)-2-[(4-methyl-2-sulfanylidene-1,3-thiazol-3-yl)oxy]hex-5-en-3-yl] benzoate |
|---|---|
| PubChem CID | 10665488 |
| Molecular Formula | C17H19NO3S2 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | [(2R,3S)-2-[(4-methyl-2-sulfanylidene-1,3-thiazol-3-yl)oxy]hex-5-en-3-yl] benzoate |
| SMILES | C=CC[C@H](OC(=O)c1ccccc1)[C@@H](C)On1c(C)csc1=S |
| InChI | InChI=1S/C17H19NO3S2/c1-4-8-15(20-16(19)14-9-6-5-7-10-14)13(3)21-18-12(2)11-23-17(18)22/h4-7,9-11,13,15H,1,8H2,2-3H3/t13-,15+/m1/s1 |
| InChIKey | FEOBJULPZFSXKN-HIFRSBDPSA-N |
| XLogP | 4.21 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|