C27H34O4 — CID 23126060
(4-benzoyloxy-3,3-dipropylhept-6-en-2-yl) benzoate (PubChem CID 23126060) has the molecular formula C27H34O4 and a molecular weight of 422.57 g/mol. Its IUPAC name is (4-benzoyloxy-3,3-dipropylhept-6-en-2-yl) benzoate.
| Compound Name | (4-benzoyloxy-3,3-dipropylhept-6-en-2-yl) benzoate |
|---|---|
| PubChem CID | 23126060 |
| Molecular Formula | C27H34O4 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | (4-benzoyloxy-3,3-dipropylhept-6-en-2-yl) benzoate |
| SMILES | C=CCC(OC(=O)c1ccccc1)C(CCC)(CCC)C(C)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H34O4/c1-5-14-24(31-26(29)23-17-12-9-13-18-23)27(19-6-2,20-7-3)21(4)30-25(28)22-15-10-8-11-16-22/h5,8-13,15-18,21,24H,1,6-7,14,19-20H2,2-4H3 |
| InChIKey | GNMDXBBISBQTPU-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|