C32H44O4 — CID 172551640
(4-benzoyloxy-3,3-diethyl-6-methyltridec-7-en-2-yl) benzoate (PubChem CID 172551640) has the molecular formula C32H44O4 and a molecular weight of 492.70 g/mol. Its IUPAC name is (4-benzoyloxy-3,3-diethyl-6-methyltridec-7-en-2-yl) benzoate.
| Compound Name | (4-benzoyloxy-3,3-diethyl-6-methyltridec-7-en-2-yl) benzoate |
|---|---|
| PubChem CID | 172551640 |
| Molecular Formula | C32H44O4 |
| Molecular Weight | 492.70 g/mol |
| Exact Mass | 492.32 |
| IUPAC Name | (4-benzoyloxy-3,3-diethyl-6-methyltridec-7-en-2-yl) benzoate |
| SMILES | CCCCCC=CC(C)CC(OC(=O)c1ccccc1)C(CC)(CC)C(C)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C32H44O4/c1-6-9-10-11-14-19-25(4)24-29(36-31(34)28-22-17-13-18-23-28)32(7-2,8-3)26(5)35-30(33)27-20-15-12-16-21-27/h12-23,25-26,29H,6-11,24H2,1-5H3 |
| InChIKey | CISPAVDJGSXZNG-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.70 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|