C29H38O4 — CID 172551638
(4-benzoyloxy-3,6-dimethyltridec-7-en-2-yl) benzoate (PubChem CID 172551638) has the molecular formula C29H38O4 and a molecular weight of 450.62 g/mol. Its IUPAC name is (4-benzoyloxy-3,6-dimethyltridec-7-en-2-yl) benzoate.
| Compound Name | (4-benzoyloxy-3,6-dimethyltridec-7-en-2-yl) benzoate |
|---|---|
| PubChem CID | 172551638 |
| Molecular Formula | C29H38O4 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.28 |
| IUPAC Name | (4-benzoyloxy-3,6-dimethyltridec-7-en-2-yl) benzoate |
| SMILES | CCCCCC=CC(C)CC(OC(=O)c1ccccc1)C(C)C(C)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C29H38O4/c1-5-6-7-8-11-16-22(2)21-27(33-29(31)26-19-14-10-15-20-26)23(3)24(4)32-28(30)25-17-12-9-13-18-25/h9-20,22-24,27H,5-8,21H2,1-4H3 |
| InChIKey | RWVMXYQLOJJZJR-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|