C26H37N3O3 — CID 45258619
[(2S,3R,4E,8E,10E)-2-azido-1-hydroxy-9-methyloctadeca-4,8,10-trien-3-yl] benzoate (PubChem CID 45258619) has the molecular formula C26H37N3O3 and a molecular weight of 439.60 g/mol. Its IUPAC name is [(2S,3R,4E,8E,10E)-2-azido-1-hydroxy-9-methyloctadeca-4,8,10-trien-3-yl] benzoate.
| Compound Name | [(2S,3R,4E,8E,10E)-2-azido-1-hydroxy-9-methyloctadeca-4,8,10-trien-3-yl] benzoate |
|---|---|
| PubChem CID | 45258619 |
| Molecular Formula | C26H37N3O3 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.28 |
| IUPAC Name | [(2S,3R,4E,8E,10E)-2-azido-1-hydroxy-9-methyloctadeca-4,8,10-trien-3-yl] benzoate |
| SMILES | CCCCCCC/C=C/C(C)=C/CC/C=C/[C@@H](OC(=O)c1ccccc1)[C@H](CO)N=[N+]=[N-] |
| InChI | InChI=1S/C26H37N3O3/c1-3-4-5-6-7-8-11-16-22(2)17-12-9-15-20-25(24(21-30)28-29-27)32-26(31)23-18-13-10-14-19-23/h10-11,13-20,24-25,30H,3-9,12,21H2,1-2H3/b16-11+,20-15+,22-17+/t24-,25+/m0/s1 |
| InChIKey | IRXXYICUHMDKIS-WWLVTEAISA-N |
| XLogP | 7.08 |
| TPSA | 95.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|