C31H39N3O8 — CID 56626157
[(2S,3R)-1-[[(4aR,6S,7R,8R,8aR)-7,8-dihydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]-2-azidoundec-4-en-3-yl] benzoate (PubChem CID 56626157) has the molecular formula C31H39N3O8 and a molecular weight of 581.67 g/mol. Its IUPAC name is [(2S,3R)-1-[[(4aR,6S,7R,8R,8aR)-7,8-dihydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]-2-azidoundec-4-en-3-yl] benzoate.
| Compound Name | [(2S,3R)-1-[[(4aR,6S,7R,8R,8aR)-7,8-dihydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]-2-azidoundec-4-en-3-yl] benzoate |
|---|---|
| PubChem CID | 56626157 |
| Molecular Formula | C31H39N3O8 |
| Molecular Weight | 581.67 g/mol |
| Exact Mass | 581.27 |
| IUPAC Name | [(2S,3R)-1-[[(4aR,6S,7R,8R,8aR)-7,8-dihydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]-2-azidoundec-4-en-3-yl] benzoate |
| SMILES | CCCCCCC=C[C@@H](OC(=O)c1ccccc1)[C@H](CO[C@H]1O[C@@H]2COC(c3ccccc3)O[C@@H]2[C@H](O)[C@H]1O)N=[N+]=[N-] |
| InChI | InChI=1S/C31H39N3O8/c1-2-3-4-5-6-13-18-24(40-29(37)21-14-9-7-10-15-21)23(33-34-32)19-38-31-27(36)26(35)28-25(41-31)20-39-30(42-28)22-16-11-8-12-17-22/h7-18,23-28,30-31,35-36H,2-6,19-20H2,1H3/t23-,24+,25+,26+,27+,28-,30?,31-/m0/s1 |
| InChIKey | PPNRCOYGPXZUPP-OOOYZOCCSA-N |
| XLogP | 4.99 |
| TPSA | 152.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.67 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|