C24H39N3O3Si — CID 152761516
[(E,2S,3R)-2-azido-1-dimethylsilyl-1-[(2-methylpropan-2-yl)oxy]undec-4-en-3-yl] benzoate (PubChem CID 152761516) has the molecular formula C24H39N3O3Si and a molecular weight of 445.68 g/mol. Its IUPAC name is [(E,2S,3R)-2-azido-1-dimethylsilyl-1-[(2-methylpropan-2-yl)oxy]undec-4-en-3-yl] benzoate.
| Compound Name | [(E,2S,3R)-2-azido-1-dimethylsilyl-1-[(2-methylpropan-2-yl)oxy]undec-4-en-3-yl] benzoate |
|---|---|
| PubChem CID | 152761516 |
| Molecular Formula | C24H39N3O3Si |
| Molecular Weight | 445.68 g/mol |
| Exact Mass | 445.28 |
| IUPAC Name | [(E,2S,3R)-2-azido-1-dimethylsilyl-1-[(2-methylpropan-2-yl)oxy]undec-4-en-3-yl] benzoate |
| SMILES | CCCCCC/C=C/[C@@H](OC(=O)c1ccccc1)[C@H](N=[N+]=[N-])C(OC(C)(C)C)[SiH](C)C |
| InChI | InChI=1S/C24H39N3O3Si/c1-7-8-9-10-11-15-18-20(29-22(28)19-16-13-12-14-17-19)21(26-27-25)23(31(5)6)30-24(2,3)4/h12-18,20-21,23,31H,7-11H2,1-6H3/b18-15+/t20-,21+,23?/m1/s1 |
| InChIKey | PSYNTASIGBIGDJ-MCBBOQSNSA-N |
| XLogP | 6.63 |
| TPSA | 84.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.68 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|