C18H23F3O3 — CID 139725649
[(E)-1,1,1-trifluoroundec-3-en-2-yl] 4-hydroxybenzoate (PubChem CID 139725649) has the molecular formula C18H23F3O3 and a molecular weight of 344.37 g/mol. Its IUPAC name is [(E)-1,1,1-trifluoroundec-3-en-2-yl] 4-hydroxybenzoate.
| Compound Name | [(E)-1,1,1-trifluoroundec-3-en-2-yl] 4-hydroxybenzoate |
|---|---|
| PubChem CID | 139725649 |
| Molecular Formula | C18H23F3O3 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | [(E)-1,1,1-trifluoroundec-3-en-2-yl] 4-hydroxybenzoate |
| SMILES | CCCCCCC/C=C/C(OC(=O)c1ccc(O)cc1)C(F)(F)F |
| InChI | InChI=1S/C18H23F3O3/c1-2-3-4-5-6-7-8-9-16(18(19,20)21)24-17(23)14-10-12-15(22)13-11-14/h8-13,16,22H,2-7H2,1H3/b9-8+ |
| InChIKey | VDDUYYPRFFGPKA-CMDGGOBGSA-N |
| XLogP | 5.40 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|