C25H32O4 — CID 23125831
(3-benzoyloxy-2,4-dimethyl-3-propylhexan-2-yl) benzoate (PubChem CID 23125831) has the molecular formula C25H32O4 and a molecular weight of 396.53 g/mol. Its IUPAC name is (3-benzoyloxy-2,4-dimethyl-3-propylhexan-2-yl) benzoate.
| Compound Name | (3-benzoyloxy-2,4-dimethyl-3-propylhexan-2-yl) benzoate |
|---|---|
| PubChem CID | 23125831 |
| Molecular Formula | C25H32O4 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | (3-benzoyloxy-2,4-dimethyl-3-propylhexan-2-yl) benzoate |
| SMILES | CCCC(OC(=O)c1ccccc1)(C(C)CC)C(C)(C)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H32O4/c1-6-18-25(19(3)7-2,29-23(27)21-16-12-9-13-17-21)24(4,5)28-22(26)20-14-10-8-11-15-20/h8-17,19H,6-7,18H2,1-5H3 |
| InChIKey | TWHMIQYICJKADV-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |