C31H36O4Si — CID 53495958
[(4S,5S,6R)-6-[tert-butyl(diphenyl)silyl]oxy-5-methyl-7-oxohept-1-en-4-yl] benzoate (PubChem CID 53495958) has the molecular formula C31H36O4Si and a molecular weight of 500.71 g/mol. Its IUPAC name is [(4S,5S,6R)-6-[tert-butyl(diphenyl)silyl]oxy-5-methyl-7-oxohept-1-en-4-yl] benzoate.
| Compound Name | [(4S,5S,6R)-6-[tert-butyl(diphenyl)silyl]oxy-5-methyl-7-oxohept-1-en-4-yl] benzoate |
|---|---|
| PubChem CID | 53495958 |
| Molecular Formula | C31H36O4Si |
| Molecular Weight | 500.71 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | [(4S,5S,6R)-6-[tert-butyl(diphenyl)silyl]oxy-5-methyl-7-oxohept-1-en-4-yl] benzoate |
| SMILES | C=CC[C@H](OC(=O)c1ccccc1)[C@H](C)[C@H](C=O)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C31H36O4Si/c1-6-16-28(34-30(33)25-17-10-7-11-18-25)24(2)29(23-32)35-36(31(3,4)5,26-19-12-8-13-20-26)27-21-14-9-15-22-27/h6-15,17-24,28-29H,1,16H2,2-5H3/t24-,28-,29-/m0/s1 |
| InChIKey | QOFWVQFGYSTLPW-GHPJVDHGSA-N |
| XLogP | 5.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.71 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|