C30H36O6SSi — CID 10769071
[(2S,3R)-3-[tert-butyl(diphenyl)silyl]oxy-2-methylsulfonyloxyhex-5-enyl] benzoate (PubChem CID 10769071) has the molecular formula C30H36O6SSi and a molecular weight of 552.77 g/mol. Its IUPAC name is [(2S,3R)-3-[tert-butyl(diphenyl)silyl]oxy-2-methylsulfonyloxyhex-5-enyl] benzoate.
| Compound Name | [(2S,3R)-3-[tert-butyl(diphenyl)silyl]oxy-2-methylsulfonyloxyhex-5-enyl] benzoate |
|---|---|
| PubChem CID | 10769071 |
| Molecular Formula | C30H36O6SSi |
| Molecular Weight | 552.77 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | [(2S,3R)-3-[tert-butyl(diphenyl)silyl]oxy-2-methylsulfonyloxyhex-5-enyl] benzoate |
| SMILES | C=CC[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](COC(=O)c1ccccc1)OS(C)(=O)=O |
| InChI | InChI=1S/C30H36O6SSi/c1-6-16-27(28(35-37(5,32)33)23-34-29(31)24-17-10-7-11-18-24)36-38(30(2,3)4,25-19-12-8-13-20-25)26-21-14-9-15-22-26/h6-15,17-22,27-28H,1,16,23H2,2-5H3/t27-,28+/m1/s1 |
| InChIKey | YDVSCVGNRHUHIQ-IZLXSDGUSA-N |
| XLogP | 4.71 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.77 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|