C22H30O2Si — CID 175160919
(2S,3S)-3-[tert-butyl(diphenyl)silyl]oxy-2-methylpent-4-en-1-ol (PubChem CID 175160919) has the molecular formula C22H30O2Si and a molecular weight of 354.57 g/mol. Its IUPAC name is (2S,3S)-3-[tert-butyl(diphenyl)silyl]oxy-2-methylpent-4-en-1-ol.
| Compound Name | (2S,3S)-3-[tert-butyl(diphenyl)silyl]oxy-2-methylpent-4-en-1-ol |
|---|---|
| PubChem CID | 175160919 |
| Molecular Formula | C22H30O2Si |
| Molecular Weight | 354.57 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | (2S,3S)-3-[tert-butyl(diphenyl)silyl]oxy-2-methylpent-4-en-1-ol |
| SMILES | C=C[C@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](C)CO |
| InChI | InChI=1S/C22H30O2Si/c1-6-21(18(2)17-23)24-25(22(3,4)5,19-13-9-7-10-14-19)20-15-11-8-12-16-20/h6-16,18,21,23H,1,17H2,2-5H3/t18-,21-/m0/s1 |
| InChIKey | WBGCRJSOASBZEO-RXVVDRJESA-N |
| XLogP | 3.75 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.57 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|