C46H50O2Si2 — CID 11028852
tert-butyl-[(1R,2R)-2-[tert-butyl(diphenyl)silyl]oxy-1,2-diphenylethoxy]-diphenylsilane (PubChem CID 11028852) has the molecular formula C46H50O2Si2 and a molecular weight of 691.08 g/mol. Its IUPAC name is tert-butyl-[(1R,2R)-2-[tert-butyl(diphenyl)silyl]oxy-1,2-diphenylethoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(1R,2R)-2-[tert-butyl(diphenyl)silyl]oxy-1,2-diphenylethoxy]-diphenylsilane |
|---|---|
| PubChem CID | 11028852 |
| Molecular Formula | C46H50O2Si2 |
| Molecular Weight | 691.08 g/mol |
| Exact Mass | 690.33 |
| IUPAC Name | tert-butyl-[(1R,2R)-2-[tert-butyl(diphenyl)silyl]oxy-1,2-diphenylethoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](O[C@H](c1ccccc1)[C@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C46H50O2Si2/c1-45(2,3)49(39-29-17-9-18-30-39,40-31-19-10-20-32-40)47-43(37-25-13-7-14-26-37)44(38-27-15-8-16-28-38)48-50(46(4,5)6,41-33-21-11-22-34-41)42-35-23-12-24-36-42/h7-36,43-44H,1-6H3/t43-,44-/m1/s1 |
| InChIKey | FYCLXYWHUPLCEV-NDOUMJCMSA-N |
| XLogP | 9.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.08 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|