C31H32OSi — CID 135009658
tert-butyl-[(E)-1,3-diphenylprop-2-enoxy]-diphenylsilane (PubChem CID 135009658) has the molecular formula C31H32OSi and a molecular weight of 448.68 g/mol. Its IUPAC name is tert-butyl-[(E)-1,3-diphenylprop-2-enoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(E)-1,3-diphenylprop-2-enoxy]-diphenylsilane |
|---|---|
| PubChem CID | 135009658 |
| Molecular Formula | C31H32OSi |
| Molecular Weight | 448.68 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | tert-butyl-[(E)-1,3-diphenylprop-2-enoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](OC(/C=C/c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H32OSi/c1-31(2,3)33(28-20-12-6-13-21-28,29-22-14-7-15-23-29)32-30(27-18-10-5-11-19-27)25-24-26-16-8-4-9-17-26/h4-25,30H,1-3H3/b25-24+ |
| InChIKey | VAWDEPWYUHXNQN-OCOZRVBESA-N |
| XLogP | 7.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.68 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|