C24H25NOSi — CID 18653746
(2R)-2-[tert-butyl(diphenyl)silyl]oxy-2-phenylacetonitrile (PubChem CID 18653746) has the molecular formula C24H25NOSi and a molecular weight of 371.56 g/mol. Its IUPAC name is (2R)-2-[tert-butyl(diphenyl)silyl]oxy-2-phenylacetonitrile.
| Compound Name | (2R)-2-[tert-butyl(diphenyl)silyl]oxy-2-phenylacetonitrile |
|---|---|
| PubChem CID | 18653746 |
| Molecular Formula | C24H25NOSi |
| Molecular Weight | 371.56 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | (2R)-2-[tert-butyl(diphenyl)silyl]oxy-2-phenylacetonitrile |
| SMILES | CC(C)(C)[Si](O[C@@H](C#N)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H25NOSi/c1-24(2,3)27(21-15-9-5-10-16-21,22-17-11-6-12-18-22)26-23(19-25)20-13-7-4-8-14-20/h4-18,23H,1-3H3/t23-/m0/s1 |
| InChIKey | KSLSPYITBLIDHB-QHCPKHFHSA-N |
| XLogP | 4.83 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.56 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|