C29H35NO3Si — CID 102433786
(2S,3R,4R)-2-[tert-butyl(diphenyl)silyl]oxy-4-(methoxymethoxy)-3-methyl-4-phenylbutanenitrile (PubChem CID 102433786) has the molecular formula C29H35NO3Si and a molecular weight of 473.69 g/mol. Its IUPAC name is (2S,3R,4R)-2-[tert-butyl(diphenyl)silyl]oxy-4-(methoxymethoxy)-3-methyl-4-phenylbutanenitrile.
| Compound Name | (2S,3R,4R)-2-[tert-butyl(diphenyl)silyl]oxy-4-(methoxymethoxy)-3-methyl-4-phenylbutanenitrile |
|---|---|
| PubChem CID | 102433786 |
| Molecular Formula | C29H35NO3Si |
| Molecular Weight | 473.69 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | (2S,3R,4R)-2-[tert-butyl(diphenyl)silyl]oxy-4-(methoxymethoxy)-3-methyl-4-phenylbutanenitrile |
| SMILES | COCO[C@@H](c1ccccc1)[C@@H](C)[C@@H](C#N)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H35NO3Si/c1-23(28(32-22-31-5)24-15-9-6-10-16-24)27(21-30)33-34(29(2,3)4,25-17-11-7-12-18-25)26-19-13-8-14-20-26/h6-20,23,27-28H,22H2,1-5H3/t23-,27+,28+/m0/s1 |
| InChIKey | IMFCQWFWKUFSJK-MLKSZZLFSA-N |
| XLogP | 5.45 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.69 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|