C28H33NO4Si — CID 177474808
(2S,4R)-2-[tert-butyl(diphenyl)silyl]oxy-3,4-dihydroxy-5-phenylmethoxypentanenitrile (PubChem CID 177474808) has the molecular formula C28H33NO4Si and a molecular weight of 475.66 g/mol. Its IUPAC name is (2S,4R)-2-[tert-butyl(diphenyl)silyl]oxy-3,4-dihydroxy-5-phenylmethoxypentanenitrile.
| Compound Name | (2S,4R)-2-[tert-butyl(diphenyl)silyl]oxy-3,4-dihydroxy-5-phenylmethoxypentanenitrile |
|---|---|
| PubChem CID | 177474808 |
| Molecular Formula | C28H33NO4Si |
| Molecular Weight | 475.66 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | (2S,4R)-2-[tert-butyl(diphenyl)silyl]oxy-3,4-dihydroxy-5-phenylmethoxypentanenitrile |
| SMILES | CC(C)(C)[Si](O[C@@H](C#N)C(O)[C@H](O)COCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H33NO4Si/c1-28(2,3)34(23-15-9-5-10-16-23,24-17-11-6-12-18-24)33-26(19-29)27(31)25(30)21-32-20-22-13-7-4-8-14-22/h4-18,25-27,30-31H,20-21H2,1-3H3/t25-,26+,27?/m1/s1 |
| InChIKey | DYERISHGKGETKW-JZGSEIKYSA-N |
| XLogP | 3.39 |
| TPSA | 82.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.66 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|