C28H36O4Si — CID 11784542
(2S,3S)-5-[tert-butyl(diphenyl)silyl]oxy-1-phenylmethoxypentane-2,3-diol (PubChem CID 11784542) has the molecular formula C28H36O4Si and a molecular weight of 464.68 g/mol. Its IUPAC name is (2S,3S)-5-[tert-butyl(diphenyl)silyl]oxy-1-phenylmethoxypentane-2,3-diol.
| Compound Name | (2S,3S)-5-[tert-butyl(diphenyl)silyl]oxy-1-phenylmethoxypentane-2,3-diol |
|---|---|
| PubChem CID | 11784542 |
| Molecular Formula | C28H36O4Si |
| Molecular Weight | 464.68 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | (2S,3S)-5-[tert-butyl(diphenyl)silyl]oxy-1-phenylmethoxypentane-2,3-diol |
| SMILES | CC(C)(C)[Si](OCC[C@H](O)[C@@H](O)COCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H36O4Si/c1-28(2,3)33(24-15-9-5-10-16-24,25-17-11-6-12-18-25)32-20-19-26(29)27(30)22-31-21-23-13-7-4-8-14-23/h4-18,26-27,29-30H,19-22H2,1-3H3/t26-,27-/m0/s1 |
| InChIKey | RGUGZGZKMJMWCX-SVBPBHIXSA-N |
| XLogP | 3.89 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.68 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|