C29H36O2Si — CID 10026512
(E,3S,4R)-1-[tert-butyl(diphenyl)silyl]oxy-4-methyl-6-phenylhex-5-en-3-ol (PubChem CID 10026512) has the molecular formula C29H36O2Si and a molecular weight of 444.69 g/mol. Its IUPAC name is (E,3S,4R)-1-[tert-butyl(diphenyl)silyl]oxy-4-methyl-6-phenylhex-5-en-3-ol.
| Compound Name | (E,3S,4R)-1-[tert-butyl(diphenyl)silyl]oxy-4-methyl-6-phenylhex-5-en-3-ol |
|---|---|
| PubChem CID | 10026512 |
| Molecular Formula | C29H36O2Si |
| Molecular Weight | 444.69 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | (E,3S,4R)-1-[tert-butyl(diphenyl)silyl]oxy-4-methyl-6-phenylhex-5-en-3-ol |
| SMILES | C[C@H](/C=C/c1ccccc1)[C@@H](O)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H36O2Si/c1-24(20-21-25-14-8-5-9-15-25)28(30)22-23-31-32(29(2,3)4,26-16-10-6-11-17-26)27-18-12-7-13-19-27/h5-21,24,28,30H,22-23H2,1-4H3/b21-20+/t24-,28+/m1/s1 |
| InChIKey | WZKNVNUTCWIGID-FCJFDANSSA-N |
| XLogP | 5.66 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.69 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|