C34H38O2Si — CID 139655776
tert-butyl-[3-methyl-5-(4-phenoxyphenyl)pent-4-enoxy]-diphenylsilane (PubChem CID 139655776) has the molecular formula C34H38O2Si and a molecular weight of 506.76 g/mol. Its IUPAC name is tert-butyl-[3-methyl-5-(4-phenoxyphenyl)pent-4-enoxy]-diphenylsilane.
| Compound Name | tert-butyl-[3-methyl-5-(4-phenoxyphenyl)pent-4-enoxy]-diphenylsilane |
|---|---|
| PubChem CID | 139655776 |
| Molecular Formula | C34H38O2Si |
| Molecular Weight | 506.76 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | tert-butyl-[3-methyl-5-(4-phenoxyphenyl)pent-4-enoxy]-diphenylsilane |
| SMILES | CC(C=Cc1ccc(Oc2ccccc2)cc1)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C34H38O2Si/c1-28(20-21-29-22-24-31(25-23-29)36-30-14-8-5-9-15-30)26-27-35-37(34(2,3)4,32-16-10-6-11-17-32)33-18-12-7-13-19-33/h5-25,28H,26-27H2,1-4H3 |
| InChIKey | FHZSUHYCRNXWEZ-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.76 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|