C27H38O2Si — CID 71551406
(4S,5E,7S)-9-[tert-butyl(diphenyl)silyl]oxy-5,7-dimethylnona-1,5-dien-4-ol (PubChem CID 71551406) has the molecular formula C27H38O2Si and a molecular weight of 422.69 g/mol. Its IUPAC name is (4S,5E,7S)-9-[tert-butyl(diphenyl)silyl]oxy-5,7-dimethylnona-1,5-dien-4-ol.
| Compound Name | (4S,5E,7S)-9-[tert-butyl(diphenyl)silyl]oxy-5,7-dimethylnona-1,5-dien-4-ol |
|---|---|
| PubChem CID | 71551406 |
| Molecular Formula | C27H38O2Si |
| Molecular Weight | 422.69 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | (4S,5E,7S)-9-[tert-butyl(diphenyl)silyl]oxy-5,7-dimethylnona-1,5-dien-4-ol |
| SMILES | C=CC[C@H](O)/C(C)=C/[C@@H](C)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H38O2Si/c1-7-14-26(28)23(3)21-22(2)19-20-29-30(27(4,5)6,24-15-10-8-11-16-24)25-17-12-9-13-18-25/h7-13,15-18,21-22,26,28H,1,14,19-20H2,2-6H3/b23-21+/t22-,26-/m0/s1 |
| InChIKey | SHBLQWVYUQVCOH-SZUSGRMQSA-N |
| XLogP | 5.47 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.69 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|