C23H34O3Si — CID 69285405
2-[(2S)-4-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]propane-1,3-diol (PubChem CID 69285405) has the molecular formula C23H34O3Si and a molecular weight of 386.61 g/mol. Its IUPAC name is 2-[(2S)-4-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]propane-1,3-diol.
| Compound Name | 2-[(2S)-4-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]propane-1,3-diol |
|---|---|
| PubChem CID | 69285405 |
| Molecular Formula | C23H34O3Si |
| Molecular Weight | 386.61 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | 2-[(2S)-4-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]propane-1,3-diol |
| SMILES | C[C@@H](CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(CO)CO |
| InChI | InChI=1S/C23H34O3Si/c1-19(20(17-24)18-25)15-16-26-27(23(2,3)4,21-11-7-5-8-12-21)22-13-9-6-10-14-22/h5-14,19-20,24-25H,15-18H2,1-4H3/t19-/m0/s1 |
| InChIKey | SXFBJDDVDFMMSG-IBGZPJMESA-N |
| XLogP | 3.19 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.61 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|