C22H28O2Si — CID 23624368
(3R)-1-[tert-butyl(diphenyl)silyl]oxyhex-5-yn-3-ol (PubChem CID 23624368) has the molecular formula C22H28O2Si and a molecular weight of 352.55 g/mol. Its IUPAC name is (3R)-1-[tert-butyl(diphenyl)silyl]oxyhex-5-yn-3-ol.
| Compound Name | (3R)-1-[tert-butyl(diphenyl)silyl]oxyhex-5-yn-3-ol |
|---|---|
| PubChem CID | 23624368 |
| Molecular Formula | C22H28O2Si |
| Molecular Weight | 352.55 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | (3R)-1-[tert-butyl(diphenyl)silyl]oxyhex-5-yn-3-ol |
| SMILES | C#CC[C@@H](O)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C22H28O2Si/c1-5-12-19(23)17-18-24-25(22(2,3)4,20-13-8-6-9-14-20)21-15-10-7-11-16-21/h1,6-11,13-16,19,23H,12,17-18H2,2-4H3/t19-/m1/s1 |
| InChIKey | MRJLMGYDPAOMMB-LJQANCHMSA-N |
| XLogP | 3.34 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.55 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|