C39H48O3Si2 — CID 11342574
(3R,5R)-1,5-bis[[tert-butyl(diphenyl)silyl]oxy]hept-6-yn-3-ol (PubChem CID 11342574) has the molecular formula C39H48O3Si2 and a molecular weight of 620.98 g/mol. Its IUPAC name is (3R,5R)-1,5-bis[[tert-butyl(diphenyl)silyl]oxy]hept-6-yn-3-ol.
| Compound Name | (3R,5R)-1,5-bis[[tert-butyl(diphenyl)silyl]oxy]hept-6-yn-3-ol |
|---|---|
| PubChem CID | 11342574 |
| Molecular Formula | C39H48O3Si2 |
| Molecular Weight | 620.98 g/mol |
| Exact Mass | 620.31 |
| IUPAC Name | (3R,5R)-1,5-bis[[tert-butyl(diphenyl)silyl]oxy]hept-6-yn-3-ol |
| SMILES | C#C[C@@H](C[C@H](O)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C39H48O3Si2/c1-8-33(42-44(39(5,6)7,36-25-17-11-18-26-36)37-27-19-12-20-28-37)31-32(40)29-30-41-43(38(2,3)4,34-21-13-9-14-22-34)35-23-15-10-16-24-35/h1,9-28,32-33,40H,29-31H2,2-7H3/t32-,33+/m1/s1 |
| InChIKey | VVLJVKCQQVETOR-SAIUNTKASA-N |
| XLogP | 6.28 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.98 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|