C38H64O3Si3 — CID 11331241
tert-butyl-diphenyl-[(3R,5R)-3-triethylsilyloxy-5-tri(propan-2-yl)silyloxyhept-6-ynoxy]silane (PubChem CID 11331241) has the molecular formula C38H64O3Si3 and a molecular weight of 653.19 g/mol. Its IUPAC name is tert-butyl-diphenyl-[(3R,5R)-3-triethylsilyloxy-5-tri(propan-2-yl)silyloxyhept-6-ynoxy]silane.
| Compound Name | tert-butyl-diphenyl-[(3R,5R)-3-triethylsilyloxy-5-tri(propan-2-yl)silyloxyhept-6-ynoxy]silane |
|---|---|
| PubChem CID | 11331241 |
| Molecular Formula | C38H64O3Si3 |
| Molecular Weight | 653.19 g/mol |
| Exact Mass | 652.42 |
| IUPAC Name | tert-butyl-diphenyl-[(3R,5R)-3-triethylsilyloxy-5-tri(propan-2-yl)silyloxyhept-6-ynoxy]silane |
| SMILES | C#C[C@@H](C[C@@H](CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)O[Si](CC)(CC)CC)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C38H64O3Si3/c1-14-34(41-43(31(5)6,32(7)8)33(9)10)30-35(40-42(15-2,16-3)17-4)28-29-39-44(38(11,12)13,36-24-20-18-21-25-36)37-26-22-19-23-27-37/h1,18-27,31-35H,15-17,28-30H2,2-13H3/t34-,35+/m0/s1 |
| InChIKey | AWWCDIHZBKLLDX-OIDHKYIRSA-N |
| XLogP | 9.93 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.19 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|