C33H54O4Si2 — CID 10030936
[(2R,3S)-5-[tert-butyl(diphenyl)silyl]oxy-2-methyl-3-triethylsilyloxypentyl] 2,2-dimethylpropanoate (PubChem CID 10030936) has the molecular formula C33H54O4Si2 and a molecular weight of 570.96 g/mol. Its IUPAC name is [(2R,3S)-5-[tert-butyl(diphenyl)silyl]oxy-2-methyl-3-triethylsilyloxypentyl] 2,2-dimethylpropanoate.
| Compound Name | [(2R,3S)-5-[tert-butyl(diphenyl)silyl]oxy-2-methyl-3-triethylsilyloxypentyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10030936 |
| Molecular Formula | C33H54O4Si2 |
| Molecular Weight | 570.96 g/mol |
| Exact Mass | 570.36 |
| IUPAC Name | [(2R,3S)-5-[tert-butyl(diphenyl)silyl]oxy-2-methyl-3-triethylsilyloxypentyl] 2,2-dimethylpropanoate |
| SMILES | CC[Si](CC)(CC)O[C@@H](CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](C)COC(=O)C(C)(C)C |
| InChI | InChI=1S/C33H54O4Si2/c1-11-38(12-2,13-3)37-30(27(4)26-35-31(34)32(5,6)7)24-25-36-39(33(8,9)10,28-20-16-14-17-21-28)29-22-18-15-19-23-29/h14-23,27,30H,11-13,24-26H2,1-10H3/t27-,30+/m1/s1 |
| InChIKey | OXASJDMVWBRRLO-OFSOJUDTSA-N |
| XLogP | 7.57 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.96 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|