C37H64O4Si3 — CID 11388220
7-[tert-butyl(dimethyl)silyl]oxy-9-[tert-butyl(diphenyl)silyl]oxy-4-triethylsilyloxynonanal (PubChem CID 11388220) has the molecular formula C37H64O4Si3 and a molecular weight of 657.17 g/mol. Its IUPAC name is 7-[tert-butyl(dimethyl)silyl]oxy-9-[tert-butyl(diphenyl)silyl]oxy-4-triethylsilyloxynonanal.
| Compound Name | 7-[tert-butyl(dimethyl)silyl]oxy-9-[tert-butyl(diphenyl)silyl]oxy-4-triethylsilyloxynonanal |
|---|---|
| PubChem CID | 11388220 |
| Molecular Formula | C37H64O4Si3 |
| Molecular Weight | 657.17 g/mol |
| Exact Mass | 656.41 |
| IUPAC Name | 7-[tert-butyl(dimethyl)silyl]oxy-9-[tert-butyl(diphenyl)silyl]oxy-4-triethylsilyloxynonanal |
| SMILES | CC[Si](CC)(CC)OC(CCC=O)CCC(CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C37H64O4Si3/c1-12-43(13-2,14-3)41-32(22-21-30-38)27-28-33(40-42(10,11)36(4,5)6)29-31-39-44(37(7,8)9,34-23-17-15-18-24-34)35-25-19-16-20-26-35/h15-20,23-26,30,32-33H,12-14,21-22,27-29,31H2,1-11H3 |
| InChIKey | LSQCTMJGDHVEGW-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.17 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|