C29H43NO3Si2 — CID 101050304
tert-butyl-[(3R)-3-(2-methyl-1,3-oxazol-4-yl)-3-triethylsilyloxypropoxy]-diphenylsilane (PubChem CID 101050304) has the molecular formula C29H43NO3Si2 and a molecular weight of 509.84 g/mol. Its IUPAC name is tert-butyl-[(3R)-3-(2-methyl-1,3-oxazol-4-yl)-3-triethylsilyloxypropoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(3R)-3-(2-methyl-1,3-oxazol-4-yl)-3-triethylsilyloxypropoxy]-diphenylsilane |
|---|---|
| PubChem CID | 101050304 |
| Molecular Formula | C29H43NO3Si2 |
| Molecular Weight | 509.84 g/mol |
| Exact Mass | 509.28 |
| IUPAC Name | tert-butyl-[(3R)-3-(2-methyl-1,3-oxazol-4-yl)-3-triethylsilyloxypropoxy]-diphenylsilane |
| SMILES | CC[Si](CC)(CC)O[C@H](CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)c1coc(C)n1 |
| InChI | InChI=1S/C29H43NO3Si2/c1-8-34(9-2,10-3)33-28(27-23-31-24(4)30-27)21-22-32-35(29(5,6)7,25-17-13-11-14-18-25)26-19-15-12-16-20-26/h11-20,23,28H,8-10,21-22H2,1-7H3/t28-/m1/s1 |
| InChIKey | IJLLIIBKRHZNSC-MUUNZHRXSA-N |
| XLogP | 7.01 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.84 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|