C24H34O2Si — CID 11025376
[(1R,2S)-2-[(2R)-4-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]cyclopropyl]methanol (PubChem CID 11025376) has the molecular formula C24H34O2Si and a molecular weight of 382.62 g/mol. Its IUPAC name is [(1R,2S)-2-[(2R)-4-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]cyclopropyl]methanol.
| Compound Name | [(1R,2S)-2-[(2R)-4-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]cyclopropyl]methanol |
|---|---|
| PubChem CID | 11025376 |
| Molecular Formula | C24H34O2Si |
| Molecular Weight | 382.62 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | [(1R,2S)-2-[(2R)-4-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]cyclopropyl]methanol |
| SMILES | C[C@H](CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H]1C[C@H]1CO |
| InChI | InChI=1S/C24H34O2Si/c1-19(23-17-20(23)18-25)15-16-26-27(24(2,3)4,21-11-7-5-8-12-21)22-13-9-6-10-14-22/h5-14,19-20,23,25H,15-18H2,1-4H3/t19-,20+,23+/m1/s1 |
| InChIKey | HQZIIVQOZZCDLF-QTEQDKRBSA-N |
| XLogP | 4.22 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.62 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|