C25H36O2Si — CID 11133052
(1S)-1-[(1R,2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]-3-methylbutan-1-ol (PubChem CID 11133052) has the molecular formula C25H36O2Si and a molecular weight of 396.65 g/mol. Its IUPAC name is (1S)-1-[(1R,2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]-3-methylbutan-1-ol.
| Compound Name | (1S)-1-[(1R,2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 11133052 |
| Molecular Formula | C25H36O2Si |
| Molecular Weight | 396.65 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | (1S)-1-[(1R,2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]-3-methylbutan-1-ol |
| SMILES | CC(C)C[C@H](O)[C@@H]1C[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H36O2Si/c1-19(2)16-24(26)23-17-20(23)18-27-28(25(3,4)5,21-12-8-6-9-13-21)22-14-10-7-11-15-22/h6-15,19-20,23-24,26H,16-18H2,1-5H3/t20-,23+,24-/m0/s1 |
| InChIKey | DCZQJZJUTBBXLM-ZTCOLXNVSA-N |
| XLogP | 4.61 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.65 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|