C26H39NO2SSi — CID 174054652
tert-butyl-[[(1S)-1-[(1R,2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]ethyl]amino]-oxidosulfanium (PubChem CID 174054652) has the molecular formula C26H39NO2SSi and a molecular weight of 457.76 g/mol. Its IUPAC name is tert-butyl-[[(1S)-1-[(1R,2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]ethyl]amino]-oxidosulfanium.
| Compound Name | tert-butyl-[[(1S)-1-[(1R,2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]ethyl]amino]-oxidosulfanium |
|---|---|
| PubChem CID | 174054652 |
| Molecular Formula | C26H39NO2SSi |
| Molecular Weight | 457.76 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | tert-butyl-[[(1S)-1-[(1R,2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]ethyl]amino]-oxidosulfanium |
| SMILES | C[C@H](N[S+]([O-])C(C)(C)C)[C@@H]1C[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H39NO2SSi/c1-20(27-30(28)25(2,3)4)24-18-21(24)19-29-31(26(5,6)7,22-14-10-8-11-15-22)23-16-12-9-13-17-23/h8-17,20-21,24,27H,18-19H2,1-7H3/t20-,21-,24-,30?/m0/s1 |
| InChIKey | ZCGZAOLHCDOHOS-LCAXODFVSA-N |
| XLogP | 4.64 |
| TPSA | 44.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.76 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|