C27H39NO2SSi — CID 71763875
(NE,R)-N-[(2R)-2-[(1S,2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]propylidene]-2-methylpropane-2-sulfinamide (PubChem CID 71763875) has the molecular formula C27H39NO2SSi and a molecular weight of 469.77 g/mol. Its IUPAC name is (NE,R)-N-[(2R)-2-[(1S,2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]propylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (NE,R)-N-[(2R)-2-[(1S,2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]propylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 71763875 |
| Molecular Formula | C27H39NO2SSi |
| Molecular Weight | 469.77 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | (NE,R)-N-[(2R)-2-[(1S,2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]propylidene]-2-methylpropane-2-sulfinamide |
| SMILES | C[C@@H](/C=N/[S@](=O)C(C)(C)C)[C@@H]1C[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H39NO2SSi/c1-21(19-28-31(29)26(2,3)4)25-18-22(25)20-30-32(27(5,6)7,23-14-10-8-11-15-23)24-16-12-9-13-17-24/h8-17,19,21-22,25H,18,20H2,1-7H3/b28-19+/t21-,22+,25-,31+/m0/s1 |
| InChIKey | YZFCFCRGAHICNT-UYJUIUCOSA-N |
| XLogP | 5.37 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.77 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|