C23H33NO2SSi — CID 11452753
(NE,S)-N-[(2R)-2-[tert-butyl(diphenyl)silyl]oxypropylidene]-2-methylpropane-2-sulfinamide (PubChem CID 11452753) has the molecular formula C23H33NO2SSi and a molecular weight of 415.68 g/mol. Its IUPAC name is (NE,S)-N-[(2R)-2-[tert-butyl(diphenyl)silyl]oxypropylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (NE,S)-N-[(2R)-2-[tert-butyl(diphenyl)silyl]oxypropylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 11452753 |
| Molecular Formula | C23H33NO2SSi |
| Molecular Weight | 415.68 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | (NE,S)-N-[(2R)-2-[tert-butyl(diphenyl)silyl]oxypropylidene]-2-methylpropane-2-sulfinamide |
| SMILES | C[C@H](/C=N/[S@@](=O)C(C)(C)C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C23H33NO2SSi/c1-19(18-24-27(25)22(2,3)4)26-28(23(5,6)7,20-14-10-8-11-15-20)21-16-12-9-13-17-21/h8-19H,1-7H3/b24-18+/t19-,27+/m1/s1 |
| InChIKey | KNEXHUBTMAIPHQ-SQNCENKYSA-N |
| XLogP | 4.48 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.68 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|