C19H33NO3SSi — CID 87146449
(NE,S)-N-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-phenoxypropylidene]-2-methylpropane-2-sulfinamide (PubChem CID 87146449) has the molecular formula C19H33NO3SSi and a molecular weight of 383.63 g/mol. Its IUPAC name is (NE,S)-N-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-phenoxypropylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (NE,S)-N-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-phenoxypropylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 87146449 |
| Molecular Formula | C19H33NO3SSi |
| Molecular Weight | 383.63 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | (NE,S)-N-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-phenoxypropylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@](=O)/N=C/[C@@H](COc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H33NO3SSi/c1-18(2,3)24(21)20-14-17(23-25(7,8)19(4,5)6)15-22-16-12-10-9-11-13-16/h9-14,17H,15H2,1-8H3/b20-14+/t17-,24-/m0/s1 |
| InChIKey | HBFTVMLFENLYOF-ZSMYTMBWSA-N |
| XLogP | 4.99 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.63 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|