C14H28F3NO2SSi — CID 172787805
(S)-N-[3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutylidene]-2-methylpropane-2-sulfinamide (PubChem CID 172787805) has the molecular formula C14H28F3NO2SSi and a molecular weight of 359.53 g/mol. Its IUPAC name is (S)-N-[3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (S)-N-[3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 172787805 |
| Molecular Formula | C14H28F3NO2SSi |
| Molecular Weight | 359.53 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | (S)-N-[3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@](=O)N=CCC(O[Si](C)(C)C(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C14H28F3NO2SSi/c1-12(2,3)21(19)18-10-9-11(14(15,16)17)20-22(7,8)13(4,5)6/h10-11H,9H2,1-8H3/t11?,21-/m0/s1 |
| InChIKey | PDHNVDRUXIMFHQ-CLPBESLVSA-N |
| XLogP | 4.86 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.53 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|