C15H31NO2SSi — CID 89421058
(NE)-N-[[3-[tert-butyl(dimethyl)silyl]oxycyclobutyl]methylidene]-2-methylpropane-2-sulfinamide (PubChem CID 89421058) has the molecular formula C15H31NO2SSi and a molecular weight of 317.57 g/mol. Its IUPAC name is (NE)-N-[[3-[tert-butyl(dimethyl)silyl]oxycyclobutyl]methylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (NE)-N-[[3-[tert-butyl(dimethyl)silyl]oxycyclobutyl]methylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 89421058 |
| Molecular Formula | C15H31NO2SSi |
| Molecular Weight | 317.57 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | (NE)-N-[[3-[tert-butyl(dimethyl)silyl]oxycyclobutyl]methylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)/N=C/C1CC(O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C15H31NO2SSi/c1-14(2,3)19(17)16-11-12-9-13(10-12)18-20(7,8)15(4,5)6/h11-13H,9-10H2,1-8H3/b16-11+ |
| InChIKey | FHVSNBRITVIQCU-LFIBNONCSA-N |
| XLogP | 4.32 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.57 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|