C10H19NO2S — CID 87243728
(NE)-2-methyl-N-(oxan-4-ylmethylidene)propane-2-sulfinamide (PubChem CID 87243728) has the molecular formula C10H19NO2S and a molecular weight of 217.33 g/mol. Its IUPAC name is (NE)-2-methyl-N-(oxan-4-ylmethylidene)propane-2-sulfinamide.
| Compound Name | (NE)-2-methyl-N-(oxan-4-ylmethylidene)propane-2-sulfinamide |
|---|---|
| PubChem CID | 87243728 |
| Molecular Formula | C10H19NO2S |
| Molecular Weight | 217.33 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | (NE)-2-methyl-N-(oxan-4-ylmethylidene)propane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)/N=C/C1CCOCC1 |
| InChI | InChI=1S/C10H19NO2S/c1-10(2,3)14(12)11-8-9-4-6-13-7-5-9/h8-9H,4-7H2,1-3H3/b11-8+ |
| InChIKey | ISEYRWAHITWIMU-DHZHZOJOSA-N |
| XLogP | 1.95 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|