C11H21NO3S — CID 177490866
(NE)-N-[3-(1,3-dioxan-2-yl)propylidene]-2-methylpropane-2-sulfinamide (PubChem CID 177490866) has the molecular formula C11H21NO3S and a molecular weight of 247.36 g/mol. Its IUPAC name is (NE)-N-[3-(1,3-dioxan-2-yl)propylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (NE)-N-[3-(1,3-dioxan-2-yl)propylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 177490866 |
| Molecular Formula | C11H21NO3S |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | (NE)-N-[3-(1,3-dioxan-2-yl)propylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)/N=C/CCC1OCCCO1 |
| InChI | InChI=1S/C11H21NO3S/c1-11(2,3)16(13)12-7-4-6-10-14-8-5-9-15-10/h7,10H,4-6,8-9H2,1-3H3/b12-7+ |
| InChIKey | MLCQVHIINFPDBW-KPKJPENVSA-N |
| XLogP | 2.06 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|