About (NE)-N-[3-(1,3-dioxan-2-yl)propylidene]-2-methylpropane-2-sulfinamide
(NE)-N-[3-(1,3-dioxan-2-yl)propylidene]-2-methylpropane-2-sulfinamide (PubChem CID 177490866) has the molecular formula C11H21NO3S
and a molecular weight of 247.36 g/mol. Its IUPAC name is (NE)-N-[3-(1,3-dioxan-2-yl)propylidene]-2-methylpropane-2-sulfinamide.
Molecular Properties
| Compound Name | (NE)-N-[3-(1,3-dioxan-2-yl)propylidene]-2-methylpropane-2-sulfinamide |
| PubChem CID | 177490866 |
| Molecular Formula | C11H21NO3S |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | (NE)-N-[3-(1,3-dioxan-2-yl)propylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)/N=C/CCC1OCCCO1 |
| InChI | InChI=1S/C11H21NO3S/c1-11(2,3)16(13)12-7-4-6-10-14-8-5-9-15-10/h7,10H,4-6,8-9H2,1-3H3/b12-7+ |
| InChIKey | MLCQVHIINFPDBW-KPKJPENVSA-N |
| XLogP | 2.06 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (NE)-N-[3-(1,3-dioxan-2-yl)propylidene]-2-methylpropane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NE)-N-[3-(1,3-dioxan-2-yl)propylidene]-2-methylpropane-2-sulfinamide?
The IUPAC name of (NE)-N-[3-(1,3-dioxan-2-yl)propylidene]-2-methylpropane-2-sulfinamide (CID 177490866) is (NE)-N-[3-(1,3-dioxan-2-yl)propylidene]-2-methylpropane-2-sulfinamide.
What is the SMILES notation for (NE)-N-[3-(1,3-dioxan-2-yl)propylidene]-2-methylpropane-2-sulfinamide?
The canonical SMILES for (NE)-N-[3-(1,3-dioxan-2-yl)propylidene]-2-methylpropane-2-sulfinamide is CC(C)(C)S(=O)/N=C/CCC1OCCCO1.
What is the InChIKey of (NE)-N-[3-(1,3-dioxan-2-yl)propylidene]-2-methylpropane-2-sulfinamide?
The InChIKey is MLCQVHIINFPDBW-KPKJPENVSA-N. The full InChI is InChI=1S/C11H21NO3S/c1-11(2,3)16(13)12-7-4-6-10-14-8-5-9-15-10/h7,10H,4-6,8-9H2,1-3H3/b12-7+.
What are the key properties of (NE)-N-[3-(1,3-dioxan-2-yl)propylidene]-2-methylpropane-2-sulfinamide?
(NE)-N-[3-(1,3-dioxan-2-yl)propylidene]-2-methylpropane-2-sulfinamide has a molecular weight of 247.36 g/mol, XLogP of 2.06, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (NE)-N-[3-(1,3-dioxan-2-yl)propylidene]-2-methylpropane-2-sulfinamide is sourced from PubChem (CID 177490866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).